About diaminomethylidene(ethyl)azanium;ethene
diaminomethylidene(ethyl)azanium;ethene (PubChem CID 158043587) has the molecular formula C5H14N3+
and a molecular weight of 116.19 g/mol. Its IUPAC name is diaminomethylidene(ethyl)azanium;ethene.
Molecular Properties
| Compound Name | diaminomethylidene(ethyl)azanium;ethene |
| PubChem CID | 158043587 |
| Molecular Formula | C5H14N3+ |
| Molecular Weight | 116.19 g/mol |
| Exact Mass | 116.12 |
| IUPAC Name | diaminomethylidene(ethyl)azanium;ethene |
| SMILES | C=C.CC[NH+]=C(N)N |
| InChI | InChI=1S/C3H9N3.C2H4/c1-2-6-3(4)5;1-2/h2H2,1H3,(H4,4,5,6);1-2H2/p+1 |
| InChIKey | FIQKYVLXAOUOIR-UHFFFAOYSA-O |
| XLogP | -1.84 |
| TPSA | 66.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.19 |
| LogP ≤ 5 | -1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze diaminomethylidene(ethyl)azanium;ethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diaminomethylidene(ethyl)azanium;ethene?
The IUPAC name of diaminomethylidene(ethyl)azanium;ethene (CID 158043587) is diaminomethylidene(ethyl)azanium;ethene.
What is the SMILES notation for diaminomethylidene(ethyl)azanium;ethene?
The canonical SMILES for diaminomethylidene(ethyl)azanium;ethene is C=C.CC[NH+]=C(N)N.
What is the InChIKey of diaminomethylidene(ethyl)azanium;ethene?
The InChIKey is FIQKYVLXAOUOIR-UHFFFAOYSA-O. The full InChI is InChI=1S/C3H9N3.C2H4/c1-2-6-3(4)5;1-2/h2H2,1H3,(H4,4,5,6);1-2H2/p+1.
What are the key properties of diaminomethylidene(ethyl)azanium;ethene?
diaminomethylidene(ethyl)azanium;ethene has a molecular weight of 116.19 g/mol, XLogP of -1.84, 1 rotatable bonds, 3 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for diaminomethylidene(ethyl)azanium;ethene is sourced from PubChem (CID 158043587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).