About 1,5-bis(trimethylsilyl)penta-1,4-diyn-3-one;cobalt
1,5-bis(trimethylsilyl)penta-1,4-diyn-3-one;cobalt (PubChem CID 158043638) has the molecular formula C11H18CoOSi2
and a molecular weight of 281.37 g/mol. Its IUPAC name is 1,5-bis(trimethylsilyl)penta-1,4-diyn-3-one;cobalt.
Molecular Properties
| Compound Name | 1,5-bis(trimethylsilyl)penta-1,4-diyn-3-one;cobalt |
| PubChem CID | 158043638 |
| Molecular Formula | C11H18CoOSi2 |
| Molecular Weight | 281.37 g/mol |
| Exact Mass | 281.02 |
| IUPAC Name | 1,5-bis(trimethylsilyl)penta-1,4-diyn-3-one;cobalt |
| SMILES | C[Si](C)(C)C#CC(=O)C#C[Si](C)(C)C.[Co] |
| InChI | InChI=1S/C11H18OSi2.Co/c1-13(2,3)9-7-11(12)8-10-14(4,5)6;/h1-6H3; |
| InChIKey | FIQOXULBXDURIH-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.37 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_one_yne_A(1)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,5-bis(trimethylsilyl)penta-1,4-diyn-3-one;cobalt with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-bis(trimethylsilyl)penta-1,4-diyn-3-one;cobalt?
The IUPAC name of 1,5-bis(trimethylsilyl)penta-1,4-diyn-3-one;cobalt (CID 158043638) is 1,5-bis(trimethylsilyl)penta-1,4-diyn-3-one;cobalt.
What is the SMILES notation for 1,5-bis(trimethylsilyl)penta-1,4-diyn-3-one;cobalt?
The canonical SMILES for 1,5-bis(trimethylsilyl)penta-1,4-diyn-3-one;cobalt is C[Si](C)(C)C#CC(=O)C#C[Si](C)(C)C.[Co].
What is the InChIKey of 1,5-bis(trimethylsilyl)penta-1,4-diyn-3-one;cobalt?
The InChIKey is FIQOXULBXDURIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18OSi2.Co/c1-13(2,3)9-7-11(12)8-10-14(4,5)6;/h1-6H3;.
What are the key properties of 1,5-bis(trimethylsilyl)penta-1,4-diyn-3-one;cobalt?
1,5-bis(trimethylsilyl)penta-1,4-diyn-3-one;cobalt has a molecular weight of 281.37 g/mol, XLogP of 2.31, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-bis(trimethylsilyl)penta-1,4-diyn-3-one;cobalt is sourced from PubChem (CID 158043638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).