C16H14F5N5O — CID 158044217
3-(1,1-difluoroethyl)-7-methyl-6-[6-[(2S)-1,1,1-trifluoropropan-2-yl]oxy-3-pyridinyl]-[1,2,4]triazolo[4,3-b]pyridazine (PubChem CID 158044217) has the molecular formula C16H14F5N5O and a molecular weight of 387.31 g/mol. Its IUPAC name is 3-(1,1-difluoroethyl)-7-methyl-6-[6-[(2S)-1,1,1-trifluoropropan-2-yl]oxy-3-pyridinyl]-[1,2,4]triazolo[4,3-b]pyridazine.
| Compound Name | 3-(1,1-difluoroethyl)-7-methyl-6-[6-[(2S)-1,1,1-trifluoropropan-2-yl]oxy-3-pyridinyl]-[1,2,4]triazolo[4,3-b]pyridazine |
|---|---|
| PubChem CID | 158044217 |
| Molecular Formula | C16H14F5N5O |
| Molecular Weight | 387.31 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | 3-(1,1-difluoroethyl)-7-methyl-6-[6-[(2S)-1,1,1-trifluoropropan-2-yl]oxy-3-pyridinyl]-[1,2,4]triazolo[4,3-b]pyridazine |
| SMILES | Cc1cc2nnc(C(C)(F)F)n2nc1-c1ccc(O[C@@H](C)C(F)(F)F)nc1 |
| InChI | InChI=1S/C16H14F5N5O/c1-8-6-11-23-24-14(15(3,17)18)26(11)25-13(8)10-4-5-12(22-7-10)27-9(2)16(19,20)21/h4-7,9H,1-3H3/t9-/m0/s1 |
| InChIKey | ZFGGXDAALZMMTM-VIFPVBQESA-N |
| XLogP | 3.94 |
| TPSA | 65.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.31 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |