C17H16F3NO2 — CID 158044450
2,2,2-trifluoroacetate;1,1,2-trimethylbenzo[e]indol-3-ium (PubChem CID 158044450) has the molecular formula C17H16F3NO2 and a molecular weight of 323.31 g/mol. Its IUPAC name is 2,2,2-trifluoroacetate;1,1,2-trimethylbenzo[e]indol-3-ium.
| Compound Name | 2,2,2-trifluoroacetate;1,1,2-trimethylbenzo[e]indol-3-ium |
|---|---|
| PubChem CID | 158044450 |
| Molecular Formula | C17H16F3NO2 |
| Molecular Weight | 323.31 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | 2,2,2-trifluoroacetate;1,1,2-trimethylbenzo[e]indol-3-ium |
| SMILES | CC1=[NH+]c2ccc3ccccc3c2C1(C)C.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C15H15N.C2HF3O2/c1-10-15(2,3)14-12-7-5-4-6-11(12)8-9-13(14)16-10;3-2(4,5)1(6)7/h4-9H,1-3H3;(H,6,7) |
| InChIKey | FISVSRJOEUNOEF-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 54.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.31 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |