C20H21N2O3S+ — CID 158045334
[4-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]quinolin-1-ium-1-yl]methanesulfonic acid (PubChem CID 158045334) has the molecular formula C20H21N2O3S+ and a molecular weight of 369.47 g/mol. Its IUPAC name is [4-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]quinolin-1-ium-1-yl]methanesulfonic acid.
| Compound Name | [4-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]quinolin-1-ium-1-yl]methanesulfonic acid |
|---|---|
| PubChem CID | 158045334 |
| Molecular Formula | C20H21N2O3S+ |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | [4-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]quinolin-1-ium-1-yl]methanesulfonic acid |
| SMILES | CN(C)c1ccc(/C=C/c2cc[n+](CS(=O)(=O)O)c3ccccc23)cc1 |
| InChI | InChI=1S/C20H20N2O3S/c1-21(2)18-11-8-16(9-12-18)7-10-17-13-14-22(15-26(23,24)25)20-6-4-3-5-19(17)20/h3-14H,15H2,1-2H3/p+1 |
| InChIKey | IEAJRCMGJLYFNJ-UHFFFAOYSA-O |
| XLogP | 3.21 |
| TPSA | 61.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|