C23H19ClF3N3O3S — CID 158045673
2-chloro-4-[3-[1-[4-hydroxy-1-methyl-5-[4-(trifluoromethyl)phenyl]pyrazol-3-yl]ethylideneamino]-2-sulfanylidenepropyl]benzoic acid (PubChem CID 158045673) has the molecular formula C23H19ClF3N3O3S and a molecular weight of 509.94 g/mol. Its IUPAC name is 2-chloro-4-[3-[1-[4-hydroxy-1-methyl-5-[4-(trifluoromethyl)phenyl]pyrazol-3-yl]ethylideneamino]-2-sulfanylidenepropyl]benzoic acid.
| Compound Name | 2-chloro-4-[3-[1-[4-hydroxy-1-methyl-5-[4-(trifluoromethyl)phenyl]pyrazol-3-yl]ethylideneamino]-2-sulfanylidenepropyl]benzoic acid |
|---|---|
| PubChem CID | 158045673 |
| Molecular Formula | C23H19ClF3N3O3S |
| Molecular Weight | 509.94 g/mol |
| Exact Mass | 509.08 |
| IUPAC Name | 2-chloro-4-[3-[1-[4-hydroxy-1-methyl-5-[4-(trifluoromethyl)phenyl]pyrazol-3-yl]ethylideneamino]-2-sulfanylidenepropyl]benzoic acid |
| SMILES | C/C(=N\CC(=S)Cc1ccc(C(=O)O)c(Cl)c1)c1nn(C)c(-c2ccc(C(F)(F)F)cc2)c1O |
| InChI | InChI=1S/C23H19ClF3N3O3S/c1-12(28-11-16(34)9-13-3-8-17(22(32)33)18(24)10-13)19-21(31)20(30(2)29-19)14-4-6-15(7-5-14)23(25,26)27/h3-8,10,31H,9,11H2,1-2H3,(H,32,33)/b28-12+ |
| InChIKey | JFHASHAHYPTHIG-KVSWJAHQSA-N |
| XLogP | 5.58 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.94 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|