C20H21N3O6 — CID 158045986
2-[C-(5,6-dihydro-1,4,2-dioxazin-3-yl)-N-methoxycarbonimidoyl]phenol;N-methoxy-1-benzofuran-3-imine (PubChem CID 158045986) has the molecular formula C20H21N3O6 and a molecular weight of 399.40 g/mol. Its IUPAC name is 2-[C-(5,6-dihydro-1,4,2-dioxazin-3-yl)-N-methoxycarbonimidoyl]phenol;N-methoxy-1-benzofuran-3-imine.
| Compound Name | 2-[C-(5,6-dihydro-1,4,2-dioxazin-3-yl)-N-methoxycarbonimidoyl]phenol;N-methoxy-1-benzofuran-3-imine |
|---|---|
| PubChem CID | 158045986 |
| Molecular Formula | C20H21N3O6 |
| Molecular Weight | 399.40 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | 2-[C-(5,6-dihydro-1,4,2-dioxazin-3-yl)-N-methoxycarbonimidoyl]phenol;N-methoxy-1-benzofuran-3-imine |
| SMILES | CON=C(C1=NOCCO1)c1ccccc1O.CON=C1COc2ccccc21 |
| InChI | InChI=1S/C11H12N2O4.C9H9NO2/c1-15-12-10(11-13-17-7-6-16-11)8-4-2-3-5-9(8)14;1-11-10-8-6-12-9-5-3-2-4-7(8)9/h2-5,14H,6-7H2,1H3;2-5H,6H2,1H3 |
| InChIKey | FIXNCOOIGGAZCJ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 103.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.40 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|