About 5-diazocyclopenta-1,3-diene
5-diazocyclopenta-1,3-diene (PubChem CID 158046292) has the molecular formula C10H8N4
and a molecular weight of 184.20 g/mol. Its IUPAC name is 5-diazocyclopenta-1,3-diene.
Molecular Properties
| Compound Name | 5-diazocyclopenta-1,3-diene |
| PubChem CID | 158046292 |
| Molecular Formula | C10H8N4 |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 5-diazocyclopenta-1,3-diene |
| SMILES | [N-]=[N+]=C1C=CC=C1.[N-]=[N+]=C1C=CC=C1 |
| InChI | InChI=1S/2C5H4N2/c2*6-7-5-3-1-2-4-5/h2*1-4H |
| InChIKey | FIYKEVUQASEXSF-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 72.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 5-diazocyclopenta-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-diazocyclopenta-1,3-diene?
The IUPAC name of 5-diazocyclopenta-1,3-diene (CID 158046292) is 5-diazocyclopenta-1,3-diene.
What is the SMILES notation for 5-diazocyclopenta-1,3-diene?
The canonical SMILES for 5-diazocyclopenta-1,3-diene is [N-]=[N+]=C1C=CC=C1.[N-]=[N+]=C1C=CC=C1.
What is the InChIKey of 5-diazocyclopenta-1,3-diene?
The InChIKey is FIYKEVUQASEXSF-UHFFFAOYSA-N. The full InChI is InChI=1S/2C5H4N2/c2*6-7-5-3-1-2-4-5/h2*1-4H.
What are the key properties of 5-diazocyclopenta-1,3-diene?
5-diazocyclopenta-1,3-diene has a molecular weight of 184.20 g/mol, XLogP of 1.57, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-diazocyclopenta-1,3-diene is sourced from PubChem (CID 158046292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).