C38H30N4O7 — CID 158046296
1,3-dihydroindol-2-one;2-(1-methylindol-3-yl)-2-oxoacetic acid;2-(1-methylindol-3-yl)-2-(2-oxo-1H-indol-3-ylidene)acetic acid (PubChem CID 158046296) has the molecular formula C38H30N4O7 and a molecular weight of 654.68 g/mol. Its IUPAC name is 1,3-dihydroindol-2-one;2-(1-methylindol-3-yl)-2-oxoacetic acid;2-(1-methylindol-3-yl)-2-(2-oxo-1H-indol-3-ylidene)acetic acid.
| Compound Name | 1,3-dihydroindol-2-one;2-(1-methylindol-3-yl)-2-oxoacetic acid;2-(1-methylindol-3-yl)-2-(2-oxo-1H-indol-3-ylidene)acetic acid |
|---|---|
| PubChem CID | 158046296 |
| Molecular Formula | C38H30N4O7 |
| Molecular Weight | 654.68 g/mol |
| Exact Mass | 654.21 |
| IUPAC Name | 1,3-dihydroindol-2-one;2-(1-methylindol-3-yl)-2-oxoacetic acid;2-(1-methylindol-3-yl)-2-(2-oxo-1H-indol-3-ylidene)acetic acid |
| SMILES | Cn1cc(C(=O)C(=O)O)c2ccccc21.Cn1cc(C(C(=O)O)=C2C(=O)Nc3ccccc32)c2ccccc21.O=C1Cc2ccccc2N1 |
| InChI | InChI=1S/C19H14N2O3.C11H9NO3.C8H7NO/c1-21-10-13(11-6-3-5-9-15(11)21)17(19(23)24)16-12-7-2-4-8-14(12)20-18(16)22;1-12-6-8(10(13)11(14)15)7-4-2-3-5-9(7)12;10-8-5-6-3-1-2-4-7(6)9-8/h2-10H,1H3,(H,20,22)(H,23,24);2-6H,1H3,(H,14,15);1-4H,5H2,(H,9,10) |
| InChIKey | FIYKUHVTNIVDID-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 159.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.68 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|