C28H31F5N2O — CID 158046320
(1S,3R)-1-[4-[2-(3-ethylazetidin-1-yl)ethoxy]-2,6-difluorophenyl]-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydroindeno[2,1-c]pyridine (PubChem CID 158046320) has the molecular formula C28H31F5N2O and a molecular weight of 506.56 g/mol. Its IUPAC name is (1S,3R)-1-[4-[2-(3-ethylazetidin-1-yl)ethoxy]-2,6-difluorophenyl]-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydroindeno[2,1-c]pyridine.
| Compound Name | (1S,3R)-1-[4-[2-(3-ethylazetidin-1-yl)ethoxy]-2,6-difluorophenyl]-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydroindeno[2,1-c]pyridine |
|---|---|
| PubChem CID | 158046320 |
| Molecular Formula | C28H31F5N2O |
| Molecular Weight | 506.56 g/mol |
| Exact Mass | 506.24 |
| IUPAC Name | (1S,3R)-1-[4-[2-(3-ethylazetidin-1-yl)ethoxy]-2,6-difluorophenyl]-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydroindeno[2,1-c]pyridine |
| SMILES | CCC1CN(CCOc2cc(F)c([C@@H]3C4=C(C[C@@H](C)N3CC(F)(F)F)c3ccccc3C4)c(F)c2)C1 |
| InChI | InChI=1S/C28H31F5N2O/c1-3-18-14-34(15-18)8-9-36-20-12-24(29)26(25(30)13-20)27-23-11-19-6-4-5-7-21(19)22(23)10-17(2)35(27)16-28(31,32)33/h4-7,12-13,17-18,27H,3,8-11,14-16H2,1-2H3/t17-,27+/m1/s1 |
| InChIKey | FIYMCBMLEWTSQE-CRYYWNKWSA-N |
| XLogP | 6.39 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.56 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |