C17H33O4P — CID 158047175
2-[(4S,5R)-5-[(Z,5R,6R)-7-methoxyphosphanyl-5,6-dimethylhept-3-en-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethanol (PubChem CID 158047175) has the molecular formula C17H33O4P and a molecular weight of 332.42 g/mol. Its IUPAC name is 2-[(4S,5R)-5-[(Z,5R,6R)-7-methoxyphosphanyl-5,6-dimethylhept-3-en-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethanol.
| Compound Name | 2-[(4S,5R)-5-[(Z,5R,6R)-7-methoxyphosphanyl-5,6-dimethylhept-3-en-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethanol |
|---|---|
| PubChem CID | 158047175 |
| Molecular Formula | C17H33O4P |
| Molecular Weight | 332.42 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | 2-[(4S,5R)-5-[(Z,5R,6R)-7-methoxyphosphanyl-5,6-dimethylhept-3-en-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethanol |
| SMILES | COPC[C@H](C)[C@H](C)/C=C\C(C)[C@H]1OC(C)(C)O[C@H]1CCO |
| InChI | InChI=1S/C17H33O4P/c1-12(14(3)11-22-19-6)7-8-13(2)16-15(9-10-18)20-17(4,5)21-16/h7-8,12-16,18,22H,9-11H2,1-6H3/b8-7-/t12-,13?,14+,15+,16-/m1/s1 |
| InChIKey | VKECXLLTVKTQPR-RUQCAXIHSA-N |
| XLogP | 3.59 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.42 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|