C21H17ClF2N2O4 — CID 158047939
methyl 2-chloropyridine-4-carboxylate;methyl 2-[(2,6-difluorophenyl)methyl]pyridine-4-carboxylate (PubChem CID 158047939) has the molecular formula C21H17ClF2N2O4 and a molecular weight of 434.83 g/mol. Its IUPAC name is methyl 2-chloropyridine-4-carboxylate;methyl 2-[(2,6-difluorophenyl)methyl]pyridine-4-carboxylate.
| Compound Name | methyl 2-chloropyridine-4-carboxylate;methyl 2-[(2,6-difluorophenyl)methyl]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 158047939 |
| Molecular Formula | C21H17ClF2N2O4 |
| Molecular Weight | 434.83 g/mol |
| Exact Mass | 434.08 |
| IUPAC Name | methyl 2-chloropyridine-4-carboxylate;methyl 2-[(2,6-difluorophenyl)methyl]pyridine-4-carboxylate |
| SMILES | COC(=O)c1ccnc(Cc2c(F)cccc2F)c1.COC(=O)c1ccnc(Cl)c1 |
| InChI | InChI=1S/C14H11F2NO2.C7H6ClNO2/c1-19-14(18)9-5-6-17-10(7-9)8-11-12(15)3-2-4-13(11)16;1-11-7(10)5-2-3-9-6(8)4-5/h2-7H,8H2,1H3;2-4H,1H3 |
| InChIKey | FJDHPIDUOJZNLT-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.83 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|