C9H12F4OS — CID 158047941
3-methyl-5-(1,1,3,3-tetrafluorobutyl)thiolan-2-one (PubChem CID 158047941) has the molecular formula C9H12F4OS and a molecular weight of 244.25 g/mol. Its IUPAC name is 3-methyl-5-(1,1,3,3-tetrafluorobutyl)thiolan-2-one.
| Compound Name | 3-methyl-5-(1,1,3,3-tetrafluorobutyl)thiolan-2-one |
|---|---|
| PubChem CID | 158047941 |
| Molecular Formula | C9H12F4OS |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | 3-methyl-5-(1,1,3,3-tetrafluorobutyl)thiolan-2-one |
| SMILES | CC1CC(C(F)(F)CC(C)(F)F)SC1=O |
| InChI | InChI=1S/C9H12F4OS/c1-5-3-6(15-7(5)14)9(12,13)4-8(2,10)11/h5-6H,3-4H2,1-2H3 |
| InChIKey | FJDHXEWWOYZJRL-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|