C19H14ClFN4O2S — CID 158048383
3-[2-(4-carbamimidoyl-2-fluorophenyl)-2-oxoethyl]-N-(5-chloro-2-pyridinyl)thiophene-2-carboxamide (PubChem CID 158048383) has the molecular formula C19H14ClFN4O2S and a molecular weight of 416.87 g/mol. Its IUPAC name is 3-[2-(4-carbamimidoyl-2-fluorophenyl)-2-oxoethyl]-N-(5-chloro-2-pyridinyl)thiophene-2-carboxamide.
| Compound Name | 3-[2-(4-carbamimidoyl-2-fluorophenyl)-2-oxoethyl]-N-(5-chloro-2-pyridinyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 158048383 |
| Molecular Formula | C19H14ClFN4O2S |
| Molecular Weight | 416.87 g/mol |
| Exact Mass | 416.05 |
| IUPAC Name | 3-[2-(4-carbamimidoyl-2-fluorophenyl)-2-oxoethyl]-N-(5-chloro-2-pyridinyl)thiophene-2-carboxamide |
| SMILES | [H]/N=C(\N)c1ccc(C(=O)Cc2ccsc2C(=O)Nc2ccc(Cl)cn2)c(F)c1 |
| InChI | InChI=1S/C19H14ClFN4O2S/c20-12-2-4-16(24-9-12)25-19(27)17-10(5-6-28-17)8-15(26)13-3-1-11(18(22)23)7-14(13)21/h1-7,9H,8H2,(H3,22,23)(H,24,25,27) |
| InChIKey | SVZPURUXRZWODL-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 108.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.87 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|