C23H35N5O5 — CID 158050171
[1-[2-[hydroxy-(4-hydroxy-4-methylpiperidin-1-yl)methyl]imino-4-methoxy-1,3-dihydroindol-7-yl]piperidin-3-yl]methyl carbamate (PubChem CID 158050171) has the molecular formula C23H35N5O5 and a molecular weight of 461.56 g/mol. Its IUPAC name is [1-[2-[hydroxy-(4-hydroxy-4-methylpiperidin-1-yl)methyl]imino-4-methoxy-1,3-dihydroindol-7-yl]piperidin-3-yl]methyl carbamate.
| Compound Name | [1-[2-[hydroxy-(4-hydroxy-4-methylpiperidin-1-yl)methyl]imino-4-methoxy-1,3-dihydroindol-7-yl]piperidin-3-yl]methyl carbamate |
|---|---|
| PubChem CID | 158050171 |
| Molecular Formula | C23H35N5O5 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.26 |
| IUPAC Name | [1-[2-[hydroxy-(4-hydroxy-4-methylpiperidin-1-yl)methyl]imino-4-methoxy-1,3-dihydroindol-7-yl]piperidin-3-yl]methyl carbamate |
| SMILES | COc1ccc(N2CCCC(COC(N)=O)C2)c2c1CC(=NC(O)N1CCC(C)(O)CC1)N2 |
| InChI | InChI=1S/C23H35N5O5/c1-23(31)7-10-27(11-8-23)22(30)26-19-12-16-18(32-2)6-5-17(20(16)25-19)28-9-3-4-15(13-28)14-33-21(24)29/h5-6,15,22,30-31H,3-4,7-14H2,1-2H3,(H2,24,29)(H,25,26) |
| InChIKey | FJJOSXXGZLLTKO-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 132.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|