C21H21F4N5O2S2 — CID 158051191
5-(2-cyclopropyl-2-oxoethyl)-2-fluoro-4-methyl-N-[2-[4-[(2S)-1,1,1-trifluoropropan-2-yl]-1,2,4-triazol-3-yl]-1,3-thiazol-4-yl]benzamide;sulfane (PubChem CID 158051191) has the molecular formula C21H21F4N5O2S2 and a molecular weight of 515.56 g/mol. Its IUPAC name is 5-(2-cyclopropyl-2-oxoethyl)-2-fluoro-4-methyl-N-[2-[4-[(2S)-1,1,1-trifluoropropan-2-yl]-1,2,4-triazol-3-yl]-1,3-thiazol-4-yl]benzamide;sulfane.
| Compound Name | 5-(2-cyclopropyl-2-oxoethyl)-2-fluoro-4-methyl-N-[2-[4-[(2S)-1,1,1-trifluoropropan-2-yl]-1,2,4-triazol-3-yl]-1,3-thiazol-4-yl]benzamide;sulfane |
|---|---|
| PubChem CID | 158051191 |
| Molecular Formula | C21H21F4N5O2S2 |
| Molecular Weight | 515.56 g/mol |
| Exact Mass | 515.11 |
| IUPAC Name | 5-(2-cyclopropyl-2-oxoethyl)-2-fluoro-4-methyl-N-[2-[4-[(2S)-1,1,1-trifluoropropan-2-yl]-1,2,4-triazol-3-yl]-1,3-thiazol-4-yl]benzamide;sulfane |
| SMILES | Cc1cc(F)c(C(=O)Nc2csc(-c3nncn3[C@@H](C)C(F)(F)F)n2)cc1CC(=O)C1CC1.S |
| InChI | InChI=1S/C21H19F4N5O2S.H2S/c1-10-5-15(22)14(6-13(10)7-16(31)12-3-4-12)19(32)27-17-8-33-20(28-17)18-29-26-9-30(18)11(2)21(23,24)25;/h5-6,8-9,11-12H,3-4,7H2,1-2H3,(H,27,32);1H2/t11-;/m0./s1 |
| InChIKey | FJMSWLUAKCWATE-MERQFXBCSA-N |
| XLogP | 4.86 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.56 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |