C20H19N3O3 — CID 158052633
2-[(3-hydroxy-4-methoxyphenyl)methylideneamino]-1-[3-(2-methylphenyl)-1H-pyrazol-5-yl]ethanone (PubChem CID 158052633) has the molecular formula C20H19N3O3 and a molecular weight of 349.39 g/mol. Its IUPAC name is 2-[(3-hydroxy-4-methoxyphenyl)methylideneamino]-1-[3-(2-methylphenyl)-1H-pyrazol-5-yl]ethanone.
| Compound Name | 2-[(3-hydroxy-4-methoxyphenyl)methylideneamino]-1-[3-(2-methylphenyl)-1H-pyrazol-5-yl]ethanone |
|---|---|
| PubChem CID | 158052633 |
| Molecular Formula | C20H19N3O3 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | 2-[(3-hydroxy-4-methoxyphenyl)methylideneamino]-1-[3-(2-methylphenyl)-1H-pyrazol-5-yl]ethanone |
| SMILES | COc1ccc(/C=N/CC(=O)c2cc(-c3ccccc3C)n[nH]2)cc1O |
| InChI | InChI=1S/C20H19N3O3/c1-13-5-3-4-6-15(13)16-10-17(23-22-16)19(25)12-21-11-14-7-8-20(26-2)18(24)9-14/h3-11,24H,12H2,1-2H3,(H,22,23)/b21-11+ |
| InChIKey | FJQXVXDDWOYCOW-SRZZPIQSSA-N |
| XLogP | 3.40 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|