C10H24IN — CID 158053029
1,1-diethylpiperidin-1-ium;methane;iodide (PubChem CID 158053029) has the molecular formula C10H24IN and a molecular weight of 285.21 g/mol. Its IUPAC name is 1,1-diethylpiperidin-1-ium;methane;iodide.
| Compound Name | 1,1-diethylpiperidin-1-ium;methane;iodide |
|---|---|
| PubChem CID | 158053029 |
| Molecular Formula | C10H24IN |
| Molecular Weight | 285.21 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 1,1-diethylpiperidin-1-ium;methane;iodide |
| SMILES | C.CC[N+]1(CC)CCCCC1.[I-] |
| InChI | InChI=1S/C9H20N.CH4.HI/c1-3-10(4-2)8-6-5-7-9-10;;/h3-9H2,1-2H3;1H4;1H/q+1;;/p-1 |
| InChIKey | HPGXPRIUVRKTTK-UHFFFAOYSA-M |
| XLogP | -0.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.21 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|