About methanol;methyl 3-(trifluoromethyl)pyridine-4-carboxylate;3-(trifluoromethyl)pyridine-4-carbonyl chloride
methanol;methyl 3-(trifluoromethyl)pyridine-4-carboxylate;3-(trifluoromethyl)pyridine-4-carbonyl chloride (PubChem CID 158055243) has the molecular formula C16H13ClF6N2O4
and a molecular weight of 446.73 g/mol. Its IUPAC name is methanol;methyl 3-(trifluoromethyl)pyridine-4-carboxylate;3-(trifluoromethyl)pyridine-4-carbonyl chloride.
Molecular Properties
| Compound Name | methanol;methyl 3-(trifluoromethyl)pyridine-4-carboxylate;3-(trifluoromethyl)pyridine-4-carbonyl chloride |
| PubChem CID | 158055243 |
| Molecular Formula | C16H13ClF6N2O4 |
| Molecular Weight | 446.73 g/mol |
| Exact Mass | 446.05 |
| IUPAC Name | methanol;methyl 3-(trifluoromethyl)pyridine-4-carboxylate;3-(trifluoromethyl)pyridine-4-carbonyl chloride |
| SMILES | CO.COC(=O)c1ccncc1C(F)(F)F.O=C(Cl)c1ccncc1C(F)(F)F |
| InChI | InChI=1S/C8H6F3NO2.C7H3ClF3NO.CH4O/c1-14-7(13)5-2-3-12-4-6(5)8(9,10)11;8-6(13)4-1-2-12-3-5(4)7(9,10)11;1-2/h2-4H,1H3;1-3H;2H,1H3 |
| InChIKey | FJYWXPJBCDPAFM-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 89.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 446.73 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze methanol;methyl 3-(trifluoromethyl)pyridine-4-carboxylate;3-(trifluoromethyl)pyridine-4-carbonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanol;methyl 3-(trifluoromethyl)pyridine-4-carboxylate;3-(trifluoromethyl)pyridine-4-carbonyl chloride?
The IUPAC name of methanol;methyl 3-(trifluoromethyl)pyridine-4-carboxylate;3-(trifluoromethyl)pyridine-4-carbonyl chloride (CID 158055243) is methanol;methyl 3-(trifluoromethyl)pyridine-4-carboxylate;3-(trifluoromethyl)pyridine-4-carbonyl chloride.
What is the SMILES notation for methanol;methyl 3-(trifluoromethyl)pyridine-4-carboxylate;3-(trifluoromethyl)pyridine-4-carbonyl chloride?
The canonical SMILES for methanol;methyl 3-(trifluoromethyl)pyridine-4-carboxylate;3-(trifluoromethyl)pyridine-4-carbonyl chloride is CO.COC(=O)c1ccncc1C(F)(F)F.O=C(Cl)c1ccncc1C(F)(F)F.
What is the InChIKey of methanol;methyl 3-(trifluoromethyl)pyridine-4-carboxylate;3-(trifluoromethyl)pyridine-4-carbonyl chloride?
The InChIKey is FJYWXPJBCDPAFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6F3NO2.C7H3ClF3NO.CH4O/c1-14-7(13)5-2-3-12-4-6(5)8(9,10)11;8-6(13)4-1-2-12-3-5(4)7(9,10)11;1-2/h2-4H,1H3;1-3H;2H,1H3.
What are the key properties of methanol;methyl 3-(trifluoromethyl)pyridine-4-carboxylate;3-(trifluoromethyl)pyridine-4-carbonyl chloride?
methanol;methyl 3-(trifluoromethyl)pyridine-4-carboxylate;3-(trifluoromethyl)pyridine-4-carbonyl chloride has a molecular weight of 446.73 g/mol, XLogP of 3.97, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methanol;methyl 3-(trifluoromethyl)pyridine-4-carboxylate;3-(trifluoromethyl)pyridine-4-carbonyl chloride is sourced from PubChem (CID 158055243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).