C11H18O4S — CID 158055491
[(3aR,6R,6aS)-6-ethyl-2,2-dimethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxol-4-yl] acetate (PubChem CID 158055491) has the molecular formula C11H18O4S and a molecular weight of 246.33 g/mol. Its IUPAC name is [(3aR,6R,6aS)-6-ethyl-2,2-dimethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxol-4-yl] acetate.
| Compound Name | [(3aR,6R,6aS)-6-ethyl-2,2-dimethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxol-4-yl] acetate |
|---|---|
| PubChem CID | 158055491 |
| Molecular Formula | C11H18O4S |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | [(3aR,6R,6aS)-6-ethyl-2,2-dimethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxol-4-yl] acetate |
| SMILES | CC[C@H]1SC(OC(C)=O)[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C11H18O4S/c1-5-7-8-9(15-11(3,4)14-8)10(16-7)13-6(2)12/h7-10H,5H2,1-4H3/t7-,8-,9-,10?/m1/s1 |
| InChIKey | UZOVBLAMSBLAKM-PBVVMKELSA-N |
| XLogP | 1.92 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |