C25H32N2O3 — CID 158056310
9-[(5Z)-5-ethenyl-3-oxoocta-5,7-dienyl]-2-methyl-4-phenyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one (PubChem CID 158056310) has the molecular formula C25H32N2O3 and a molecular weight of 408.54 g/mol. Its IUPAC name is 9-[(5Z)-5-ethenyl-3-oxoocta-5,7-dienyl]-2-methyl-4-phenyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one.
| Compound Name | 9-[(5Z)-5-ethenyl-3-oxoocta-5,7-dienyl]-2-methyl-4-phenyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one |
|---|---|
| PubChem CID | 158056310 |
| Molecular Formula | C25H32N2O3 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.24 |
| IUPAC Name | 9-[(5Z)-5-ethenyl-3-oxoocta-5,7-dienyl]-2-methyl-4-phenyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one |
| SMILES | C=C/C=C(\C=C)CC(=O)CCN1CCC2(CC1)CN(c1ccccc1)C(=O)C(C)O2 |
| InChI | InChI=1S/C25H32N2O3/c1-4-9-21(5-2)18-23(28)12-15-26-16-13-25(14-17-26)19-27(24(29)20(3)30-25)22-10-7-6-8-11-22/h4-11,20H,1-2,12-19H2,3H3/b21-9+ |
| InChIKey | FKCDEWVUGKKHNP-ZVBGSRNCSA-N |
| XLogP | 3.92 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|