C30H29ClF3N9O3 — CID 158056596
N-[4-chloro-3-[6-(dimethylamino)-3H-imidazo[4,5-c]pyridin-2-yl]phenyl]-2-methyl-6-(trifluoromethyl)pyridine-3-carboxamide;1-N,1-N-dimethyl-4-nitrobenzene-1,3-diamine (PubChem CID 158056596) has the molecular formula C30H29ClF3N9O3 and a molecular weight of 656.07 g/mol. Its IUPAC name is N-[4-chloro-3-[6-(dimethylamino)-3H-imidazo[4,5-c]pyridin-2-yl]phenyl]-2-methyl-6-(trifluoromethyl)pyridine-3-carboxamide;1-N,1-N-dimethyl-4-nitrobenzene-1,3-diamine.
| Compound Name | N-[4-chloro-3-[6-(dimethylamino)-3H-imidazo[4,5-c]pyridin-2-yl]phenyl]-2-methyl-6-(trifluoromethyl)pyridine-3-carboxamide;1-N,1-N-dimethyl-4-nitrobenzene-1,3-diamine |
|---|---|
| PubChem CID | 158056596 |
| Molecular Formula | C30H29ClF3N9O3 |
| Molecular Weight | 656.07 g/mol |
| Exact Mass | 655.20 |
| IUPAC Name | N-[4-chloro-3-[6-(dimethylamino)-3H-imidazo[4,5-c]pyridin-2-yl]phenyl]-2-methyl-6-(trifluoromethyl)pyridine-3-carboxamide;1-N,1-N-dimethyl-4-nitrobenzene-1,3-diamine |
| SMILES | CN(C)c1ccc([N+](=O)[O-])c(N)c1.Cc1nc(C(F)(F)F)ccc1C(=O)Nc1ccc(Cl)c(-c2nc3cc(N(C)C)ncc3[nH]2)c1 |
| InChI | InChI=1S/C22H18ClF3N6O.C8H11N3O2/c1-11-13(5-7-18(28-11)22(24,25)26)21(33)29-12-4-6-15(23)14(8-12)20-30-16-9-19(32(2)3)27-10-17(16)31-20;1-10(2)6-3-4-8(11(12)13)7(9)5-6/h4-10H,1-3H3,(H,29,33)(H,30,31);3-5H,9H2,1-2H3 |
| InChIKey | FKCZEJRLFXZKEH-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 159.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.07 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|