About CID 158057721
CID 158057721 (PubChem CID 158057721) has the molecular formula C45H27BBr2N5O5
and a molecular weight of 888.36 g/mol.
Molecular Properties
| Compound Name | CID 158057721 |
| PubChem CID | 158057721 |
| Molecular Formula | C45H27BBr2N5O5 |
| Molecular Weight | 888.36 g/mol |
| Exact Mass | 886.05 |
| IUPAC Name | — |
| SMILES | Brc1ccc2[nH]c3ccc(Br)cc3c2c1.O[B]Oc1nc2ccccc2o1.c1ccc2oc(-c3ccc4[nH]c5ccc(-c6nc7ccccc7o6)cc5c4c3)nc2c1 |
| InChI | InChI=1S/C26H15N3O2.C12H7Br2N.C7H5BNO3/c1-3-7-23-21(5-1)28-25(30-23)15-9-11-19-17(13-15)18-14-16(10-12-20(18)27-19)26-29-22-6-2-4-8-24(22)31-26;13-7-1-3-11-9(5-7)10-6-8(14)2-4-12(10)15-11;10-8-12-7-9-5-3-1-2-4-6(5)11-7/h1-14,27H;1-6,15H;1-4,10H |
| InChIKey | VPMUNPLJBWFMSC-UHFFFAOYSA-N |
| XLogP | 12.52 |
| TPSA | 139.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 58 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 888.36 |
| LogP ≤ 5 | 12.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 158057721 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 158057721?
The IUPAC name of CID 158057721 (CID 158057721) is not available.
What is the SMILES notation for CID 158057721?
The canonical SMILES for CID 158057721 is Brc1ccc2[nH]c3ccc(Br)cc3c2c1.O[B]Oc1nc2ccccc2o1.c1ccc2oc(-c3ccc4[nH]c5ccc(-c6nc7ccccc7o6)cc5c4c3)nc2c1.
What is the InChIKey of CID 158057721?
The InChIKey is VPMUNPLJBWFMSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H15N3O2.C12H7Br2N.C7H5BNO3/c1-3-7-23-21(5-1)28-25(30-23)15-9-11-19-17(13-15)18-14-16(10-12-20(18)27-19)26-29-22-6-2-4-8-24(22)31-26;13-7-1-3-11-9(5-7)10-6-8(14)2-4-12(10)15-11;10-8-12-7-9-5-3-1-2-4-6(5)11-7/h1-14,27H;1-6,15H;1-4,10H.
What are the key properties of CID 158057721?
CID 158057721 has a molecular weight of 888.36 g/mol, XLogP of 12.52, 4 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 158057721 is sourced from PubChem (CID 158057721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).