C21H28N4O3S — CID 158057810
N,7-dimethyl-6-(oxan-4-ylsulfonyl)quinolin-4-amine;4,5-dimethyl-1H-pyrazole (PubChem CID 158057810) has the molecular formula C21H28N4O3S and a molecular weight of 416.55 g/mol. Its IUPAC name is N,7-dimethyl-6-(oxan-4-ylsulfonyl)quinolin-4-amine;4,5-dimethyl-1H-pyrazole.
| Compound Name | N,7-dimethyl-6-(oxan-4-ylsulfonyl)quinolin-4-amine;4,5-dimethyl-1H-pyrazole |
|---|---|
| PubChem CID | 158057810 |
| Molecular Formula | C21H28N4O3S |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | N,7-dimethyl-6-(oxan-4-ylsulfonyl)quinolin-4-amine;4,5-dimethyl-1H-pyrazole |
| SMILES | CNc1ccnc2cc(C)c(S(=O)(=O)C3CCOCC3)cc12.Cc1cn[nH]c1C |
| InChI | InChI=1S/C16H20N2O3S.C5H8N2/c1-11-9-15-13(14(17-2)3-6-18-15)10-16(11)22(19,20)12-4-7-21-8-5-12;1-4-3-6-7-5(4)2/h3,6,9-10,12H,4-5,7-8H2,1-2H3,(H,17,18);3H,1-2H3,(H,6,7) |
| InChIKey | FKGXHNVGGOCFCM-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |