About (1-methylcyclohexyl) 2-methylprop-2-enoate;2-methyl-3-(2-methylprop-2-enoyloxy)prop-2-enoic acid
(1-methylcyclohexyl) 2-methylprop-2-enoate;2-methyl-3-(2-methylprop-2-enoyloxy)prop-2-enoic acid (PubChem CID 158058117) has the molecular formula C19H28O6
and a molecular weight of 352.43 g/mol. Its IUPAC name is (1-methylcyclohexyl) 2-methylprop-2-enoate;2-methyl-3-(2-methylprop-2-enoyloxy)prop-2-enoic acid.
Molecular Properties
| Compound Name | (1-methylcyclohexyl) 2-methylprop-2-enoate;2-methyl-3-(2-methylprop-2-enoyloxy)prop-2-enoic acid |
| PubChem CID | 158058117 |
| Molecular Formula | C19H28O6 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | (1-methylcyclohexyl) 2-methylprop-2-enoate;2-methyl-3-(2-methylprop-2-enoyloxy)prop-2-enoic acid |
| SMILES | C=C(C)C(=O)OC1(C)CCCCC1.C=C(C)C(=O)OC=C(C)C(=O)O |
| InChI | InChI=1S/C11H18O2.C8H10O4/c1-9(2)10(12)13-11(3)7-5-4-6-8-11;1-5(2)8(11)12-4-6(3)7(9)10/h1,4-8H2,2-3H3;4H,1H2,2-3H3,(H,9,10) |
| InChIKey | FKHWAUIZKFIRMT-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (1-methylcyclohexyl) 2-methylprop-2-enoate;2-methyl-3-(2-methylprop-2-enoyloxy)prop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methylcyclohexyl) 2-methylprop-2-enoate;2-methyl-3-(2-methylprop-2-enoyloxy)prop-2-enoic acid?
The IUPAC name of (1-methylcyclohexyl) 2-methylprop-2-enoate;2-methyl-3-(2-methylprop-2-enoyloxy)prop-2-enoic acid (CID 158058117) is (1-methylcyclohexyl) 2-methylprop-2-enoate;2-methyl-3-(2-methylprop-2-enoyloxy)prop-2-enoic acid.
What is the SMILES notation for (1-methylcyclohexyl) 2-methylprop-2-enoate;2-methyl-3-(2-methylprop-2-enoyloxy)prop-2-enoic acid?
The canonical SMILES for (1-methylcyclohexyl) 2-methylprop-2-enoate;2-methyl-3-(2-methylprop-2-enoyloxy)prop-2-enoic acid is C=C(C)C(=O)OC1(C)CCCCC1.C=C(C)C(=O)OC=C(C)C(=O)O.
What is the InChIKey of (1-methylcyclohexyl) 2-methylprop-2-enoate;2-methyl-3-(2-methylprop-2-enoyloxy)prop-2-enoic acid?
The InChIKey is FKHWAUIZKFIRMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O2.C8H10O4/c1-9(2)10(12)13-11(3)7-5-4-6-8-11;1-5(2)8(11)12-4-6(3)7(9)10/h1,4-8H2,2-3H3;4H,1H2,2-3H3,(H,9,10).
What are the key properties of (1-methylcyclohexyl) 2-methylprop-2-enoate;2-methyl-3-(2-methylprop-2-enoyloxy)prop-2-enoic acid?
(1-methylcyclohexyl) 2-methylprop-2-enoate;2-methyl-3-(2-methylprop-2-enoyloxy)prop-2-enoic acid has a molecular weight of 352.43 g/mol, XLogP of 3.92, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methylcyclohexyl) 2-methylprop-2-enoate;2-methyl-3-(2-methylprop-2-enoyloxy)prop-2-enoic acid is sourced from PubChem (CID 158058117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).