C19H28O6 — CID 158058117
(1-methylcyclohexyl) 2-methylprop-2-enoate;2-methyl-3-(2-methylprop-2-enoyloxy)prop-2-enoic acid (PubChem CID 158058117) has the molecular formula C19H28O6 and a molecular weight of 352.43 g/mol. Its IUPAC name is (1-methylcyclohexyl) 2-methylprop-2-enoate;2-methyl-3-(2-methylprop-2-enoyloxy)prop-2-enoic acid.
| Compound Name | (1-methylcyclohexyl) 2-methylprop-2-enoate;2-methyl-3-(2-methylprop-2-enoyloxy)prop-2-enoic acid |
|---|---|
| PubChem CID | 158058117 |
| Molecular Formula | C19H28O6 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | (1-methylcyclohexyl) 2-methylprop-2-enoate;2-methyl-3-(2-methylprop-2-enoyloxy)prop-2-enoic acid |
| SMILES | C=C(C)C(=O)OC1(C)CCCCC1.C=C(C)C(=O)OC=C(C)C(=O)O |
| InChI | InChI=1S/C11H18O2.C8H10O4/c1-9(2)10(12)13-11(3)7-5-4-6-8-11;1-5(2)8(11)12-4-6(3)7(9)10/h1,4-8H2,2-3H3;4H,1H2,2-3H3,(H,9,10) |
| InChIKey | FKHWAUIZKFIRMT-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|