About (4-methyl-5-methylidene-2-oxo-1,3-dioxolan-4-yl)methyl but-3-enoate
(4-methyl-5-methylidene-2-oxo-1,3-dioxolan-4-yl)methyl but-3-enoate (PubChem CID 158058157) has the molecular formula C10H12O5
and a molecular weight of 212.20 g/mol. Its IUPAC name is (4-methyl-5-methylidene-2-oxo-1,3-dioxolan-4-yl)methyl but-3-enoate.
Molecular Properties
| Compound Name | (4-methyl-5-methylidene-2-oxo-1,3-dioxolan-4-yl)methyl but-3-enoate |
| PubChem CID | 158058157 |
| Molecular Formula | C10H12O5 |
| Molecular Weight | 212.20 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | (4-methyl-5-methylidene-2-oxo-1,3-dioxolan-4-yl)methyl but-3-enoate |
| SMILES | C=CCC(=O)OCC1(C)OC(=O)OC1=C |
| InChI | InChI=1S/C10H12O5/c1-4-5-8(11)13-6-10(3)7(2)14-9(12)15-10/h4H,1-2,5-6H2,3H3 |
| InChIKey | FKHZQTKJYRZMIK-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.20 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4-methyl-5-methylidene-2-oxo-1,3-dioxolan-4-yl)methyl but-3-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methyl-5-methylidene-2-oxo-1,3-dioxolan-4-yl)methyl but-3-enoate?
The IUPAC name of (4-methyl-5-methylidene-2-oxo-1,3-dioxolan-4-yl)methyl but-3-enoate (CID 158058157) is (4-methyl-5-methylidene-2-oxo-1,3-dioxolan-4-yl)methyl but-3-enoate.
What is the SMILES notation for (4-methyl-5-methylidene-2-oxo-1,3-dioxolan-4-yl)methyl but-3-enoate?
The canonical SMILES for (4-methyl-5-methylidene-2-oxo-1,3-dioxolan-4-yl)methyl but-3-enoate is C=CCC(=O)OCC1(C)OC(=O)OC1=C.
What is the InChIKey of (4-methyl-5-methylidene-2-oxo-1,3-dioxolan-4-yl)methyl but-3-enoate?
The InChIKey is FKHZQTKJYRZMIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O5/c1-4-5-8(11)13-6-10(3)7(2)14-9(12)15-10/h4H,1-2,5-6H2,3H3.
What are the key properties of (4-methyl-5-methylidene-2-oxo-1,3-dioxolan-4-yl)methyl but-3-enoate?
(4-methyl-5-methylidene-2-oxo-1,3-dioxolan-4-yl)methyl but-3-enoate has a molecular weight of 212.20 g/mol, XLogP of 1.54, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methyl-5-methylidene-2-oxo-1,3-dioxolan-4-yl)methyl but-3-enoate is sourced from PubChem (CID 158058157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).