C21H21ClN4O5 — CID 158058213
1-(2-chloro-4-hydroxyphenyl)-3-cyclopropylurea;7-methoxy-4-oxo-1H-quinoline-6-carboxamide (PubChem CID 158058213) has the molecular formula C21H21ClN4O5 and a molecular weight of 444.88 g/mol. Its IUPAC name is 1-(2-chloro-4-hydroxyphenyl)-3-cyclopropylurea;7-methoxy-4-oxo-1H-quinoline-6-carboxamide.
| Compound Name | 1-(2-chloro-4-hydroxyphenyl)-3-cyclopropylurea;7-methoxy-4-oxo-1H-quinoline-6-carboxamide |
|---|---|
| PubChem CID | 158058213 |
| Molecular Formula | C21H21ClN4O5 |
| Molecular Weight | 444.88 g/mol |
| Exact Mass | 444.12 |
| IUPAC Name | 1-(2-chloro-4-hydroxyphenyl)-3-cyclopropylurea;7-methoxy-4-oxo-1H-quinoline-6-carboxamide |
| SMILES | COc1cc2[nH]ccc(=O)c2cc1C(N)=O.O=C(Nc1ccc(O)cc1Cl)NC1CC1 |
| InChI | InChI=1S/C11H10N2O3.C10H11ClN2O2/c1-16-10-5-8-6(4-7(10)11(12)15)9(14)2-3-13-8;11-8-5-7(14)3-4-9(8)13-10(15)12-6-1-2-6/h2-5H,1H3,(H2,12,15)(H,13,14);3-6,14H,1-2H2,(H2,12,13,15) |
| InChIKey | FKIFRHWKJDDJGZ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 146.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.88 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|