C47H54O3 — CID 158058262
6,13-ditert-butyl-2,9-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),4(16),5,7,11(15),12-hexaene;2,8-ditert-butyl-6H-naphtho[1,2-c]isochromene (PubChem CID 158058262) has the molecular formula C47H54O3 and a molecular weight of 666.95 g/mol. Its IUPAC name is 6,13-ditert-butyl-2,9-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),4(16),5,7,11(15),12-hexaene;2,8-ditert-butyl-6H-naphtho[1,2-c]isochromene.
| Compound Name | 6,13-ditert-butyl-2,9-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),4(16),5,7,11(15),12-hexaene;2,8-ditert-butyl-6H-naphtho[1,2-c]isochromene |
|---|---|
| PubChem CID | 158058262 |
| Molecular Formula | C47H54O3 |
| Molecular Weight | 666.95 g/mol |
| Exact Mass | 666.41 |
| IUPAC Name | 6,13-ditert-butyl-2,9-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),4(16),5,7,11(15),12-hexaene;2,8-ditert-butyl-6H-naphtho[1,2-c]isochromene |
| SMILES | CC(C)(C)c1cc2c3c(c1)OCc1cc(C(C)(C)C)cc(c1-3)OC2.CC(C)(C)c1ccc2c(c1)COc1c-2ccc2cc(C(C)(C)C)ccc12 |
| InChI | InChI=1S/C25H28O.C22H26O2/c1-24(2,3)18-9-12-21-16(13-18)7-10-22-20-11-8-19(25(4,5)6)14-17(20)15-26-23(21)22;1-21(2,3)15-7-13-11-24-18-10-16(22(4,5)6)8-14-12-23-17(9-15)19(13)20(14)18/h7-14H,15H2,1-6H3;7-10H,11-12H2,1-6H3 |
| InChIKey | FKIJAVNETHJLSW-UHFFFAOYSA-N |
| XLogP | 12.73 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.95 |
| LogP ≤ 5 | 12.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |