About CID 158059021
CID 158059021 (PubChem CID 158059021) has the molecular formula C24H15BBr4N7S
and a molecular weight of 763.93 g/mol.
Molecular Properties
| Compound Name | CID 158059021 |
| PubChem CID | 158059021 |
| Molecular Formula | C24H15BBr4N7S |
| Molecular Weight | 763.93 g/mol |
| Exact Mass | 759.79 |
| IUPAC Name | — |
| SMILES | Nc1c(Br)cc(Br)c2nc3cc(Br)ccc3nc12.Nc1cccc2nc3cc(Br)ccc3nc12.[B]=NS |
| InChI | InChI=1S/C12H6Br3N3.C12H8BrN3.BHNS/c13-5-1-2-8-9(3-5)18-11-7(15)4-6(14)10(16)12(11)17-8;13-7-4-5-9-11(6-7)15-10-3-1-2-8(14)12(10)16-9;1-2-3/h1-4H,16H2;1-6H,14H2;3H |
| InChIKey | XRKCDNQYXBKRNF-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 115.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 763.93 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze CID 158059021 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 158059021?
The IUPAC name of CID 158059021 (CID 158059021) is not available.
What is the SMILES notation for CID 158059021?
The canonical SMILES for CID 158059021 is Nc1c(Br)cc(Br)c2nc3cc(Br)ccc3nc12.Nc1cccc2nc3cc(Br)ccc3nc12.[B]=NS.
What is the InChIKey of CID 158059021?
The InChIKey is XRKCDNQYXBKRNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H6Br3N3.C12H8BrN3.BHNS/c13-5-1-2-8-9(3-5)18-11-7(15)4-6(14)10(16)12(11)17-8;13-7-4-5-9-11(6-7)15-10-3-1-2-8(14)12(10)16-9;1-2-3/h1-4H,16H2;1-6H,14H2;3H.
What are the key properties of CID 158059021?
CID 158059021 has a molecular weight of 763.93 g/mol, XLogP of 7.96, 0 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 158059021 is sourced from PubChem (CID 158059021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).