C24H15F3N6O5 — CID 158059102
N-[[5-(7H-cyclopenta[b]pyridin-5-yl)-1,2,4-oxadiazol-3-yl]methyl]-5-nitro-2-oxo-1-[(3,4,5-trifluorophenyl)methyl]pyridine-3-carboxamide (PubChem CID 158059102) has the molecular formula C24H15F3N6O5 and a molecular weight of 524.42 g/mol. Its IUPAC name is N-[[5-(7H-cyclopenta[b]pyridin-5-yl)-1,2,4-oxadiazol-3-yl]methyl]-5-nitro-2-oxo-1-[(3,4,5-trifluorophenyl)methyl]pyridine-3-carboxamide.
| Compound Name | N-[[5-(7H-cyclopenta[b]pyridin-5-yl)-1,2,4-oxadiazol-3-yl]methyl]-5-nitro-2-oxo-1-[(3,4,5-trifluorophenyl)methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 158059102 |
| Molecular Formula | C24H15F3N6O5 |
| Molecular Weight | 524.42 g/mol |
| Exact Mass | 524.11 |
| IUPAC Name | N-[[5-(7H-cyclopenta[b]pyridin-5-yl)-1,2,4-oxadiazol-3-yl]methyl]-5-nitro-2-oxo-1-[(3,4,5-trifluorophenyl)methyl]pyridine-3-carboxamide |
| SMILES | O=C(NCc1noc(C2=CCc3ncccc32)n1)c1cc([N+](=O)[O-])cn(Cc2cc(F)c(F)c(F)c2)c1=O |
| InChI | InChI=1S/C24H15F3N6O5/c25-17-6-12(7-18(26)21(17)27)10-32-11-13(33(36)37)8-16(24(32)35)22(34)29-9-20-30-23(38-31-20)15-3-4-19-14(15)2-1-5-28-19/h1-3,5-8,11H,4,9-10H2,(H,29,34) |
| InChIKey | YRURIIOMDXBMOG-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 146.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.42 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|