C20H19NO — CID 158059223
5-[(1S,2S)-2-phenylcyclopentyl]oxyisoquinoline (PubChem CID 158059223) has the molecular formula C20H19NO and a molecular weight of 289.38 g/mol. Its IUPAC name is 5-[(1S,2S)-2-phenylcyclopentyl]oxyisoquinoline.
| Compound Name | 5-[(1S,2S)-2-phenylcyclopentyl]oxyisoquinoline |
|---|---|
| PubChem CID | 158059223 |
| Molecular Formula | C20H19NO |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | 5-[(1S,2S)-2-phenylcyclopentyl]oxyisoquinoline |
| SMILES | c1ccc([C@@H]2CCC[C@@H]2Oc2cccc3cnccc23)cc1 |
| InChI | InChI=1S/C20H19NO/c1-2-6-15(7-3-1)17-9-5-11-19(17)22-20-10-4-8-16-14-21-13-12-18(16)20/h1-4,6-8,10,12-14,17,19H,5,9,11H2/t17-,19-/m0/s1 |
| InChIKey | GYNXEPDGMZLVFX-HKUYNNGSSA-N |
| XLogP | 4.95 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |