About (2E)-3-(cyclohexylamino)-2-[(4-methylphenyl)methylidene]-3H-inden-1-one;methane
(2E)-3-(cyclohexylamino)-2-[(4-methylphenyl)methylidene]-3H-inden-1-one;methane (PubChem CID 158059340) has the molecular formula C24H29NO
and a molecular weight of 347.50 g/mol. Its IUPAC name is (2E)-3-(cyclohexylamino)-2-[(4-methylphenyl)methylidene]-3H-inden-1-one;methane.
Molecular Properties
| Compound Name | (2E)-3-(cyclohexylamino)-2-[(4-methylphenyl)methylidene]-3H-inden-1-one;methane |
| PubChem CID | 158059340 |
| Molecular Formula | C24H29NO |
| Molecular Weight | 347.50 g/mol |
| Exact Mass | 347.22 |
| IUPAC Name | (2E)-3-(cyclohexylamino)-2-[(4-methylphenyl)methylidene]-3H-inden-1-one;methane |
| SMILES | C.Cc1ccc(/C=C2/C(=O)c3ccccc3C2NC2CCCCC2)cc1 |
| InChI | InChI=1S/C23H25NO.CH4/c1-16-11-13-17(14-12-16)15-21-22(24-18-7-3-2-4-8-18)19-9-5-6-10-20(19)23(21)25;/h5-6,9-15,18,22,24H,2-4,7-8H2,1H3;1H4/b21-15+; |
| InChIKey | FKLOJSDUEGEPBP-NEMIEIFKSA-N |
| XLogP | 5.87 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 347.50 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2E)-3-(cyclohexylamino)-2-[(4-methylphenyl)methylidene]-3H-inden-1-one;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-3-(cyclohexylamino)-2-[(4-methylphenyl)methylidene]-3H-inden-1-one;methane?
The IUPAC name of (2E)-3-(cyclohexylamino)-2-[(4-methylphenyl)methylidene]-3H-inden-1-one;methane (CID 158059340) is (2E)-3-(cyclohexylamino)-2-[(4-methylphenyl)methylidene]-3H-inden-1-one;methane.
What is the SMILES notation for (2E)-3-(cyclohexylamino)-2-[(4-methylphenyl)methylidene]-3H-inden-1-one;methane?
The canonical SMILES for (2E)-3-(cyclohexylamino)-2-[(4-methylphenyl)methylidene]-3H-inden-1-one;methane is C.Cc1ccc(/C=C2/C(=O)c3ccccc3C2NC2CCCCC2)cc1.
What is the InChIKey of (2E)-3-(cyclohexylamino)-2-[(4-methylphenyl)methylidene]-3H-inden-1-one;methane?
The InChIKey is FKLOJSDUEGEPBP-NEMIEIFKSA-N. The full InChI is InChI=1S/C23H25NO.CH4/c1-16-11-13-17(14-12-16)15-21-22(24-18-7-3-2-4-8-18)19-9-5-6-10-20(19)23(21)25;/h5-6,9-15,18,22,24H,2-4,7-8H2,1H3;1H4/b21-15+;.
What are the key properties of (2E)-3-(cyclohexylamino)-2-[(4-methylphenyl)methylidene]-3H-inden-1-one;methane?
(2E)-3-(cyclohexylamino)-2-[(4-methylphenyl)methylidene]-3H-inden-1-one;methane has a molecular weight of 347.50 g/mol, XLogP of 5.87, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-3-(cyclohexylamino)-2-[(4-methylphenyl)methylidene]-3H-inden-1-one;methane is sourced from PubChem (CID 158059340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).