C14H34N6 — CID 15805944
5,7,12,14-tetramethyl-1,4,8,11-tetrazacyclotetradecane-6,13-diamine (PubChem CID 15805944) has the molecular formula C14H34N6 and a molecular weight of 286.47 g/mol. Its IUPAC name is 5,7,12,14-tetramethyl-1,4,8,11-tetrazacyclotetradecane-6,13-diamine.
| Compound Name | 5,7,12,14-tetramethyl-1,4,8,11-tetrazacyclotetradecane-6,13-diamine |
|---|---|
| PubChem CID | 15805944 |
| Molecular Formula | C14H34N6 |
| Molecular Weight | 286.47 g/mol |
| Exact Mass | 286.28 |
| IUPAC Name | 5,7,12,14-tetramethyl-1,4,8,11-tetrazacyclotetradecane-6,13-diamine |
| SMILES | CC1NCCNC(C)C(N)C(C)NCCNC(C)C1N |
| InChI | InChI=1S/C14H34N6/c1-9-13(15)10(2)18-7-8-20-12(4)14(16)11(3)19-6-5-17-9/h9-14,17-20H,5-8,15-16H2,1-4H3 |
| InChIKey | VIZZTSQVFVAIFS-UHFFFAOYSA-N |
| XLogP | -1.43 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.47 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |