C21H23N3O3 — CID 158060020
N-[2-[2-oxo-2-(1-oxo-3,4-dihydro-2H-pyrazino[1,2-a]indol-7-yl)ethyl]cyclopentyl]prop-2-enamide (PubChem CID 158060020) has the molecular formula C21H23N3O3 and a molecular weight of 365.43 g/mol. Its IUPAC name is N-[2-[2-oxo-2-(1-oxo-3,4-dihydro-2H-pyrazino[1,2-a]indol-7-yl)ethyl]cyclopentyl]prop-2-enamide.
| Compound Name | N-[2-[2-oxo-2-(1-oxo-3,4-dihydro-2H-pyrazino[1,2-a]indol-7-yl)ethyl]cyclopentyl]prop-2-enamide |
|---|---|
| PubChem CID | 158060020 |
| Molecular Formula | C21H23N3O3 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | N-[2-[2-oxo-2-(1-oxo-3,4-dihydro-2H-pyrazino[1,2-a]indol-7-yl)ethyl]cyclopentyl]prop-2-enamide |
| SMILES | C=CC(=O)NC1CCCC1CC(=O)c1ccc2cc3n(c2c1)CCNC3=O |
| InChI | InChI=1S/C21H23N3O3/c1-2-20(26)23-16-5-3-4-13(16)12-19(25)15-7-6-14-10-18-21(27)22-8-9-24(18)17(14)11-15/h2,6-7,10-11,13,16H,1,3-5,8-9,12H2,(H,22,27)(H,23,26) |
| InChIKey | FKNHNDRJWFRCGD-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|