About 5-bromo-2-(4-ethoxy-2,6-difluorophenyl)-1-ethyl-6-methylidene-3-phenylpyridine;ethane
5-bromo-2-(4-ethoxy-2,6-difluorophenyl)-1-ethyl-6-methylidene-3-phenylpyridine;ethane (PubChem CID 158063386) has the molecular formula C24H26BrF2NO
and a molecular weight of 462.38 g/mol. Its IUPAC name is 5-bromo-2-(4-ethoxy-2,6-difluorophenyl)-1-ethyl-6-methylidene-3-phenylpyridine;ethane.
Molecular Properties
| Compound Name | 5-bromo-2-(4-ethoxy-2,6-difluorophenyl)-1-ethyl-6-methylidene-3-phenylpyridine;ethane |
| PubChem CID | 158063386 |
| Molecular Formula | C24H26BrF2NO |
| Molecular Weight | 462.38 g/mol |
| Exact Mass | 461.12 |
| IUPAC Name | 5-bromo-2-(4-ethoxy-2,6-difluorophenyl)-1-ethyl-6-methylidene-3-phenylpyridine;ethane |
| SMILES | C=C1C(Br)=CC(c2ccccc2)=C(c2c(F)cc(OCC)cc2F)N1CC.CC |
| InChI | InChI=1S/C22H20BrF2NO.C2H6/c1-4-26-14(3)18(23)13-17(15-9-7-6-8-10-15)22(26)21-19(24)11-16(27-5-2)12-20(21)25;1-2/h6-13H,3-5H2,1-2H3;1-2H3 |
| InChIKey | FKXTWBMUAZCGAG-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 462.38 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-2-(4-ethoxy-2,6-difluorophenyl)-1-ethyl-6-methylidene-3-phenylpyridine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-(4-ethoxy-2,6-difluorophenyl)-1-ethyl-6-methylidene-3-phenylpyridine;ethane?
The IUPAC name of 5-bromo-2-(4-ethoxy-2,6-difluorophenyl)-1-ethyl-6-methylidene-3-phenylpyridine;ethane (CID 158063386) is 5-bromo-2-(4-ethoxy-2,6-difluorophenyl)-1-ethyl-6-methylidene-3-phenylpyridine;ethane.
What is the SMILES notation for 5-bromo-2-(4-ethoxy-2,6-difluorophenyl)-1-ethyl-6-methylidene-3-phenylpyridine;ethane?
The canonical SMILES for 5-bromo-2-(4-ethoxy-2,6-difluorophenyl)-1-ethyl-6-methylidene-3-phenylpyridine;ethane is C=C1C(Br)=CC(c2ccccc2)=C(c2c(F)cc(OCC)cc2F)N1CC.CC.
What is the InChIKey of 5-bromo-2-(4-ethoxy-2,6-difluorophenyl)-1-ethyl-6-methylidene-3-phenylpyridine;ethane?
The InChIKey is FKXTWBMUAZCGAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20BrF2NO.C2H6/c1-4-26-14(3)18(23)13-17(15-9-7-6-8-10-15)22(26)21-19(24)11-16(27-5-2)12-20(21)25;1-2/h6-13H,3-5H2,1-2H3;1-2H3.
What are the key properties of 5-bromo-2-(4-ethoxy-2,6-difluorophenyl)-1-ethyl-6-methylidene-3-phenylpyridine;ethane?
5-bromo-2-(4-ethoxy-2,6-difluorophenyl)-1-ethyl-6-methylidene-3-phenylpyridine;ethane has a molecular weight of 462.38 g/mol, XLogP of 7.39, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-(4-ethoxy-2,6-difluorophenyl)-1-ethyl-6-methylidene-3-phenylpyridine;ethane is sourced from PubChem (CID 158063386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).