About [2-[1-[(2-chloro-6-cyanophenyl)methyl]-3-methylindazol-6-yl]-2,2-difluoroethyl] acetate
[2-[1-[(2-chloro-6-cyanophenyl)methyl]-3-methylindazol-6-yl]-2,2-difluoroethyl] acetate (PubChem CID 158063796) has the molecular formula C20H16ClF2N3O2
and a molecular weight of 403.82 g/mol. Its IUPAC name is [2-[1-[(2-chloro-6-cyanophenyl)methyl]-3-methylindazol-6-yl]-2,2-difluoroethyl] acetate.
Molecular Properties
| Compound Name | [2-[1-[(2-chloro-6-cyanophenyl)methyl]-3-methylindazol-6-yl]-2,2-difluoroethyl] acetate |
| PubChem CID | 158063796 |
| Molecular Formula | C20H16ClF2N3O2 |
| Molecular Weight | 403.82 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | [2-[1-[(2-chloro-6-cyanophenyl)methyl]-3-methylindazol-6-yl]-2,2-difluoroethyl] acetate |
| SMILES | CC(=O)OCC(F)(F)c1ccc2c(C)nn(Cc3c(Cl)cccc3C#N)c2c1 |
| InChI | InChI=1S/C20H16ClF2N3O2/c1-12-16-7-6-15(20(22,23)11-28-13(2)27)8-19(16)26(25-12)10-17-14(9-24)4-3-5-18(17)21/h3-8H,10-11H2,1-2H3 |
| InChIKey | FKZBNAYKKSHNCK-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 67.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.82 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-[1-[(2-chloro-6-cyanophenyl)methyl]-3-methylindazol-6-yl]-2,2-difluoroethyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[1-[(2-chloro-6-cyanophenyl)methyl]-3-methylindazol-6-yl]-2,2-difluoroethyl] acetate?
The IUPAC name of [2-[1-[(2-chloro-6-cyanophenyl)methyl]-3-methylindazol-6-yl]-2,2-difluoroethyl] acetate (CID 158063796) is [2-[1-[(2-chloro-6-cyanophenyl)methyl]-3-methylindazol-6-yl]-2,2-difluoroethyl] acetate.
What is the SMILES notation for [2-[1-[(2-chloro-6-cyanophenyl)methyl]-3-methylindazol-6-yl]-2,2-difluoroethyl] acetate?
The canonical SMILES for [2-[1-[(2-chloro-6-cyanophenyl)methyl]-3-methylindazol-6-yl]-2,2-difluoroethyl] acetate is CC(=O)OCC(F)(F)c1ccc2c(C)nn(Cc3c(Cl)cccc3C#N)c2c1.
What is the InChIKey of [2-[1-[(2-chloro-6-cyanophenyl)methyl]-3-methylindazol-6-yl]-2,2-difluoroethyl] acetate?
The InChIKey is FKZBNAYKKSHNCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16ClF2N3O2/c1-12-16-7-6-15(20(22,23)11-28-13(2)27)8-19(16)26(25-12)10-17-14(9-24)4-3-5-18(17)21/h3-8H,10-11H2,1-2H3.
What are the key properties of [2-[1-[(2-chloro-6-cyanophenyl)methyl]-3-methylindazol-6-yl]-2,2-difluoroethyl] acetate?
[2-[1-[(2-chloro-6-cyanophenyl)methyl]-3-methylindazol-6-yl]-2,2-difluoroethyl] acetate has a molecular weight of 403.82 g/mol, XLogP of 4.57, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[1-[(2-chloro-6-cyanophenyl)methyl]-3-methylindazol-6-yl]-2,2-difluoroethyl] acetate is sourced from PubChem (CID 158063796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).