C29H51N5O8S — CID 158063984
6-acetyl-3-[[8-(diaminomethylideneamino)-5-[(2-ethyl-3-hydroxybutanoyl)amino]-2-(2-methylsulfanylethyl)-4-oxooctanoyl]amino]-7-methyl-4-oxooctanoic acid (PubChem CID 158063984) has the molecular formula C29H51N5O8S and a molecular weight of 629.82 g/mol. Its IUPAC name is 6-acetyl-3-[[8-(diaminomethylideneamino)-5-[(2-ethyl-3-hydroxybutanoyl)amino]-2-(2-methylsulfanylethyl)-4-oxooctanoyl]amino]-7-methyl-4-oxooctanoic acid.
| Compound Name | 6-acetyl-3-[[8-(diaminomethylideneamino)-5-[(2-ethyl-3-hydroxybutanoyl)amino]-2-(2-methylsulfanylethyl)-4-oxooctanoyl]amino]-7-methyl-4-oxooctanoic acid |
|---|---|
| PubChem CID | 158063984 |
| Molecular Formula | C29H51N5O8S |
| Molecular Weight | 629.82 g/mol |
| Exact Mass | 629.35 |
| IUPAC Name | 6-acetyl-3-[[8-(diaminomethylideneamino)-5-[(2-ethyl-3-hydroxybutanoyl)amino]-2-(2-methylsulfanylethyl)-4-oxooctanoyl]amino]-7-methyl-4-oxooctanoic acid |
| SMILES | CCC(C(=O)NC(CCCN=C(N)N)C(=O)CC(CCSC)C(=O)NC(CC(=O)O)C(=O)CC(C(C)=O)C(C)C)C(C)O |
| InChI | InChI=1S/C29H51N5O8S/c1-7-20(17(4)35)28(42)33-22(9-8-11-32-29(30)31)24(37)13-19(10-12-43-6)27(41)34-23(15-26(39)40)25(38)14-21(16(2)3)18(5)36/h16-17,19-23,35H,7-15H2,1-6H3,(H,33,42)(H,34,41)(H,39,40)(H4,30,31,32) |
| InChIKey | DKEXBLMWSFYEEM-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 231.34 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.82 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|