About 4-azidobut-1-ynylbenzene
4-azidobut-1-ynylbenzene (PubChem CID 15806508) has the molecular formula C10H9N3
and a molecular weight of 171.20 g/mol. Its IUPAC name is 4-azidobut-1-ynylbenzene.
Molecular Properties
| Compound Name | 4-azidobut-1-ynylbenzene |
| PubChem CID | 15806508 |
| Molecular Formula | C10H9N3 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.08 |
| IUPAC Name | 4-azidobut-1-ynylbenzene |
| SMILES | [N-]=[N+]=NCCC#Cc1ccccc1 |
| InChI | InChI=1S/C10H9N3/c11-13-12-9-5-4-8-10-6-2-1-3-7-10/h1-3,6-7H,5,9H2 |
| InChIKey | WCHAATWKLFLSJT-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 4-azidobut-1-ynylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-azidobut-1-ynylbenzene?
The IUPAC name of 4-azidobut-1-ynylbenzene (CID 15806508) is 4-azidobut-1-ynylbenzene.
What is the SMILES notation for 4-azidobut-1-ynylbenzene?
The canonical SMILES for 4-azidobut-1-ynylbenzene is [N-]=[N+]=NCCC#Cc1ccccc1.
What is the InChIKey of 4-azidobut-1-ynylbenzene?
The InChIKey is WCHAATWKLFLSJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N3/c11-13-12-9-5-4-8-10-6-2-1-3-7-10/h1-3,6-7H,5,9H2.
What are the key properties of 4-azidobut-1-ynylbenzene?
4-azidobut-1-ynylbenzene has a molecular weight of 171.20 g/mol, XLogP of 2.74, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-azidobut-1-ynylbenzene is sourced from PubChem (CID 15806508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).