C22H32N4O6 — CID 158065608
1-hydroxy-1-(2-methoxyphenyl)-3-propan-2-ylurea;1-hydroxy-1-(2-methoxyphenyl)-3-propylurea (PubChem CID 158065608) has the molecular formula C22H32N4O6 and a molecular weight of 448.52 g/mol. Its IUPAC name is 1-hydroxy-1-(2-methoxyphenyl)-3-propan-2-ylurea;1-hydroxy-1-(2-methoxyphenyl)-3-propylurea.
| Compound Name | 1-hydroxy-1-(2-methoxyphenyl)-3-propan-2-ylurea;1-hydroxy-1-(2-methoxyphenyl)-3-propylurea |
|---|---|
| PubChem CID | 158065608 |
| Molecular Formula | C22H32N4O6 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.23 |
| IUPAC Name | 1-hydroxy-1-(2-methoxyphenyl)-3-propan-2-ylurea;1-hydroxy-1-(2-methoxyphenyl)-3-propylurea |
| SMILES | CCCNC(=O)N(O)c1ccccc1OC.COc1ccccc1N(O)C(=O)NC(C)C |
| InChI | InChI=1S/2C11H16N2O3/c1-8(2)12-11(14)13(15)9-6-4-5-7-10(9)16-3;1-3-8-12-11(14)13(15)9-6-4-5-7-10(9)16-2/h4-8,15H,1-3H3,(H,12,14);4-7,15H,3,8H2,1-2H3,(H,12,14) |
| InChIKey | FLEMLIVHRNMRSL-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 123.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|