C82H112N8O14S2 — CID 158065881
N'-[[4-[1-[8-[4-(methylcarbamoyl)cyclohexyl]-6-oxooctyl]-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]methoxy]-N-phenyloctanediamide (PubChem CID 158065881) has the molecular formula C82H112N8O14S2 and a molecular weight of 1497.97 g/mol. Its IUPAC name is N'-[[4-[1-[8-[4-(methylcarbamoyl)cyclohexyl]-6-oxooctyl]-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]methoxy]-N-phenyloctanediamide.
| Compound Name | N'-[[4-[1-[8-[4-(methylcarbamoyl)cyclohexyl]-6-oxooctyl]-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]methoxy]-N-phenyloctanediamide |
|---|---|
| PubChem CID | 158065881 |
| Molecular Formula | C82H112N8O14S2 |
| Molecular Weight | 1497.97 g/mol |
| Exact Mass | 1496.77 |
| IUPAC Name | N'-[[4-[1-[8-[4-(methylcarbamoyl)cyclohexyl]-6-oxooctyl]-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]methoxy]-N-phenyloctanediamide |
| SMILES | CNC(=O)C1CCC(CCC(=O)CCCCCN2C(=O)CC(Sc3ccc(CONC(=O)CCCCCCC(=O)Nc4ccccc4)cc3)C2=O)CC1.CNC(=O)C1CCC(CCC(=O)CCCCCN2C(=O)CC(Sc3ccc(CONC(=O)CCCCCCC(=O)Nc4ccccc4)cc3)C2=O)CC1 |
| InChI | InChI=1S/2C41H56N4O7S/c2*1-42-40(50)32-22-17-30(18-23-32)19-24-34(46)14-8-5-11-27-45-39(49)28-36(41(45)51)53-35-25-20-31(21-26-35)29-52-44-38(48)16-10-3-2-9-15-37(47)43-33-12-6-4-7-13-33/h2*4,6-7,12-13,20-21,25-26,30,32,36H,2-3,5,8-11,14-19,22-24,27-29H2,1H3,(H,42,50)(H,43,47)(H,44,48) |
| InChIKey | FLFGRCVMDOEXCN-UHFFFAOYSA-N |
| XLogP | 13.79 |
| TPSA | 301.96 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 46 |
| Heavy Atoms | 106 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1497.97 |
| LogP ≤ 5 | 13.79 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|