C21H25BClF3O3 — CID 158066679
1-[5-[(2S)-2-chloro-2-[(2S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-2,3,4-trifluoro-6-methylphenyl]ethanone (PubChem CID 158066679) has the molecular formula C21H25BClF3O3 and a molecular weight of 428.69 g/mol. Its IUPAC name is 1-[5-[(2S)-2-chloro-2-[(2S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-2,3,4-trifluoro-6-methylphenyl]ethanone.
| Compound Name | 1-[5-[(2S)-2-chloro-2-[(2S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-2,3,4-trifluoro-6-methylphenyl]ethanone |
|---|---|
| PubChem CID | 158066679 |
| Molecular Formula | C21H25BClF3O3 |
| Molecular Weight | 428.69 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | 1-[5-[(2S)-2-chloro-2-[(2S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-2,3,4-trifluoro-6-methylphenyl]ethanone |
| SMILES | CC(=O)c1c(C)c(C[C@@H](Cl)B2OC3CC4CC(C4(C)C)[C@]3(C)O2)c(F)c(F)c1F |
| InChI | InChI=1S/C21H25BClF3O3/c1-9-12(17(24)19(26)18(25)16(9)10(2)27)8-15(23)22-28-14-7-11-6-13(20(11,3)4)21(14,5)29-22/h11,13-15H,6-8H2,1-5H3/t11?,13?,14?,15-,21+/m1/s1 |
| InChIKey | XPQJRNRPBWIPSB-ZQFMDQHHSA-N |
| XLogP | 5.03 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.69 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|