C15H17F17O2Si — CID 15806690
diethoxy-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)-methylsilane (PubChem CID 15806690) has the molecular formula C15H17F17O2Si and a molecular weight of 580.35 g/mol. Its IUPAC name is diethoxy-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)-methylsilane.
| Compound Name | diethoxy-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)-methylsilane |
|---|---|
| PubChem CID | 15806690 |
| Molecular Formula | C15H17F17O2Si |
| Molecular Weight | 580.35 g/mol |
| Exact Mass | 580.07 |
| IUPAC Name | diethoxy-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)-methylsilane |
| SMILES | CCO[Si](C)(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)OCC |
| InChI | InChI=1S/C15H17F17O2Si/c1-4-33-35(3,34-5-2)7-6-8(16,17)9(18,19)10(20,21)11(22,23)12(24,25)13(26,27)14(28,29)15(30,31)32/h4-7H2,1-3H3 |
| InChIKey | FWFYREMNEFLCAK-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.35 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|