About N-methyl-N',N'-bis(methylaminomethyl)methanediamine
N-methyl-N',N'-bis(methylaminomethyl)methanediamine (PubChem CID 15806800) has the molecular formula C6H18N4
and a molecular weight of 146.24 g/mol. Its IUPAC name is N-methyl-N',N'-bis(methylaminomethyl)methanediamine.
Molecular Properties
| Compound Name | N-methyl-N',N'-bis(methylaminomethyl)methanediamine |
| PubChem CID | 15806800 |
| Molecular Formula | C6H18N4 |
| Molecular Weight | 146.24 g/mol |
| Exact Mass | 146.15 |
| IUPAC Name | N-methyl-N',N'-bis(methylaminomethyl)methanediamine |
| SMILES | CNCN(CNC)CNC |
| InChI | InChI=1S/C6H18N4/c1-7-4-10(5-8-2)6-9-3/h7-9H,4-6H2,1-3H3 |
| InChIKey | MEEUJAGXPSVZHB-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 39.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.24 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-N',N'-bis(methylaminomethyl)methanediamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N',N'-bis(methylaminomethyl)methanediamine?
The IUPAC name of N-methyl-N',N'-bis(methylaminomethyl)methanediamine (CID 15806800) is N-methyl-N',N'-bis(methylaminomethyl)methanediamine.
What is the SMILES notation for N-methyl-N',N'-bis(methylaminomethyl)methanediamine?
The canonical SMILES for N-methyl-N',N'-bis(methylaminomethyl)methanediamine is CNCN(CNC)CNC.
What is the InChIKey of N-methyl-N',N'-bis(methylaminomethyl)methanediamine?
The InChIKey is MEEUJAGXPSVZHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H18N4/c1-7-4-10(5-8-2)6-9-3/h7-9H,4-6H2,1-3H3.
What are the key properties of N-methyl-N',N'-bis(methylaminomethyl)methanediamine?
N-methyl-N',N'-bis(methylaminomethyl)methanediamine has a molecular weight of 146.24 g/mol, XLogP of -1.18, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N',N'-bis(methylaminomethyl)methanediamine is sourced from PubChem (CID 15806800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).