About (2-oxochromen-7-yl) (2-methyl-3-oxopentyl)sulfanylformate
(2-oxochromen-7-yl) (2-methyl-3-oxopentyl)sulfanylformate (PubChem CID 158068015) has the molecular formula C16H16O5S
and a molecular weight of 320.37 g/mol. Its IUPAC name is (2-oxochromen-7-yl) (2-methyl-3-oxopentyl)sulfanylformate.
Molecular Properties
| Compound Name | (2-oxochromen-7-yl) (2-methyl-3-oxopentyl)sulfanylformate |
| PubChem CID | 158068015 |
| Molecular Formula | C16H16O5S |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | (2-oxochromen-7-yl) (2-methyl-3-oxopentyl)sulfanylformate |
| SMILES | CCC(=O)C(C)CSC(=O)Oc1ccc2ccc(=O)oc2c1 |
| InChI | InChI=1S/C16H16O5S/c1-3-13(17)10(2)9-22-16(19)20-12-6-4-11-5-7-15(18)21-14(11)8-12/h4-8,10H,3,9H2,1-2H3 |
| InChIKey | RHEZSKXOZXQHJM-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 73.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze (2-oxochromen-7-yl) (2-methyl-3-oxopentyl)sulfanylformate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-oxochromen-7-yl) (2-methyl-3-oxopentyl)sulfanylformate?
The IUPAC name of (2-oxochromen-7-yl) (2-methyl-3-oxopentyl)sulfanylformate (CID 158068015) is (2-oxochromen-7-yl) (2-methyl-3-oxopentyl)sulfanylformate.
What is the SMILES notation for (2-oxochromen-7-yl) (2-methyl-3-oxopentyl)sulfanylformate?
The canonical SMILES for (2-oxochromen-7-yl) (2-methyl-3-oxopentyl)sulfanylformate is CCC(=O)C(C)CSC(=O)Oc1ccc2ccc(=O)oc2c1.
What is the InChIKey of (2-oxochromen-7-yl) (2-methyl-3-oxopentyl)sulfanylformate?
The InChIKey is RHEZSKXOZXQHJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16O5S/c1-3-13(17)10(2)9-22-16(19)20-12-6-4-11-5-7-15(18)21-14(11)8-12/h4-8,10H,3,9H2,1-2H3.
What are the key properties of (2-oxochromen-7-yl) (2-methyl-3-oxopentyl)sulfanylformate?
(2-oxochromen-7-yl) (2-methyl-3-oxopentyl)sulfanylformate has a molecular weight of 320.37 g/mol, XLogP of 3.64, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxochromen-7-yl) (2-methyl-3-oxopentyl)sulfanylformate is sourced from PubChem (CID 158068015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).