C23H25ClFN5O3 — CID 158068151
[(2R,4S)-2-(5-chloro-2-methylphenyl)-4-fluoropyrrolidin-1-yl]-[4-[[(1R,2S,3R)-2,3-dihydroxycyclopentyl]amino]-7H-pyrrolo[3,4-d]pyrimidin-5-yl]methanone (PubChem CID 158068151) has the molecular formula C23H25ClFN5O3 and a molecular weight of 473.94 g/mol. Its IUPAC name is [(2R,4S)-2-(5-chloro-2-methylphenyl)-4-fluoropyrrolidin-1-yl]-[4-[[(1R,2S,3R)-2,3-dihydroxycyclopentyl]amino]-7H-pyrrolo[3,4-d]pyrimidin-5-yl]methanone.
| Compound Name | [(2R,4S)-2-(5-chloro-2-methylphenyl)-4-fluoropyrrolidin-1-yl]-[4-[[(1R,2S,3R)-2,3-dihydroxycyclopentyl]amino]-7H-pyrrolo[3,4-d]pyrimidin-5-yl]methanone |
|---|---|
| PubChem CID | 158068151 |
| Molecular Formula | C23H25ClFN5O3 |
| Molecular Weight | 473.94 g/mol |
| Exact Mass | 473.16 |
| IUPAC Name | [(2R,4S)-2-(5-chloro-2-methylphenyl)-4-fluoropyrrolidin-1-yl]-[4-[[(1R,2S,3R)-2,3-dihydroxycyclopentyl]amino]-7H-pyrrolo[3,4-d]pyrimidin-5-yl]methanone |
| SMILES | Cc1ccc(Cl)cc1[C@H]1C[C@H](F)CN1C(=O)C1=NCc2ncnc(N[C@@H]3CC[C@@H](O)[C@H]3O)c21 |
| InChI | InChI=1S/C23H25ClFN5O3/c1-11-2-3-12(24)6-14(11)17-7-13(25)9-30(17)23(33)20-19-16(8-26-20)27-10-28-22(19)29-15-4-5-18(31)21(15)32/h2-3,6,10,13,15,17-18,21,31-32H,4-5,7-9H2,1H3,(H,27,28,29)/t13-,15+,17+,18+,21-/m0/s1 |
| InChIKey | MJFZVFSJMLMENN-QRMQHYBJSA-N |
| XLogP | 2.35 |
| TPSA | 110.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.94 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |