About tert-butylimino(trichloro)tantalum;bis(pyridine)
tert-butylimino(trichloro)tantalum;bis(pyridine) (PubChem CID 15806990) has the molecular formula C14H19Cl3N3Ta
and a molecular weight of 516.63 g/mol. Its IUPAC name is tert-butylimino(trichloro)tantalum;bis(pyridine).
Molecular Properties
| Compound Name | tert-butylimino(trichloro)tantalum;bis(pyridine) |
| PubChem CID | 15806990 |
| Molecular Formula | C14H19Cl3N3Ta |
| Molecular Weight | 516.63 g/mol |
| Exact Mass | 515.01 |
| IUPAC Name | tert-butylimino(trichloro)tantalum;bis(pyridine) |
| SMILES | CC(C)(C)N=[Ta](Cl)(Cl)Cl.c1ccncc1.c1ccncc1 |
| InChI | InChI=1S/2C5H5N.C4H9N.3ClH.Ta/c2*1-2-4-6-5-3-1;1-4(2,3)5;;;;/h2*1-5H;1-3H3;3*1H;/q;;;;;;+3/p-3 |
| InChIKey | FMQWBQHQXABGJQ-UHFFFAOYSA-K |
| XLogP | 5.75 |
| TPSA | 38.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 516.63 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butylimino(trichloro)tantalum;bis(pyridine) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butylimino(trichloro)tantalum;bis(pyridine)?
The IUPAC name of tert-butylimino(trichloro)tantalum;bis(pyridine) (CID 15806990) is tert-butylimino(trichloro)tantalum;bis(pyridine).
What is the SMILES notation for tert-butylimino(trichloro)tantalum;bis(pyridine)?
The canonical SMILES for tert-butylimino(trichloro)tantalum;bis(pyridine) is CC(C)(C)N=[Ta](Cl)(Cl)Cl.c1ccncc1.c1ccncc1.
What is the InChIKey of tert-butylimino(trichloro)tantalum;bis(pyridine)?
The InChIKey is FMQWBQHQXABGJQ-UHFFFAOYSA-K. The full InChI is InChI=1S/2C5H5N.C4H9N.3ClH.Ta/c2*1-2-4-6-5-3-1;1-4(2,3)5;;;;/h2*1-5H;1-3H3;3*1H;/q;;;;;;+3/p-3.
What are the key properties of tert-butylimino(trichloro)tantalum;bis(pyridine)?
tert-butylimino(trichloro)tantalum;bis(pyridine) has a molecular weight of 516.63 g/mol, XLogP of 5.75, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butylimino(trichloro)tantalum;bis(pyridine) is sourced from PubChem (CID 15806990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).