C17H29F3N2O4 — CID 158070102
N-[6-[4,4-bis(methoxymethyl)piperidin-1-yl]-6-oxohexyl]-2,2,2-trifluoroacetamide (PubChem CID 158070102) has the molecular formula C17H29F3N2O4 and a molecular weight of 382.42 g/mol. Its IUPAC name is N-[6-[4,4-bis(methoxymethyl)piperidin-1-yl]-6-oxohexyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[6-[4,4-bis(methoxymethyl)piperidin-1-yl]-6-oxohexyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 158070102 |
| Molecular Formula | C17H29F3N2O4 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | N-[6-[4,4-bis(methoxymethyl)piperidin-1-yl]-6-oxohexyl]-2,2,2-trifluoroacetamide |
| SMILES | COCC1(COC)CCN(C(=O)CCCCCNC(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C17H29F3N2O4/c1-25-12-16(13-26-2)7-10-22(11-8-16)14(23)6-4-3-5-9-21-15(24)17(18,19)20/h3-13H2,1-2H3,(H,21,24) |
| InChIKey | FLSJBLWJAKVKSV-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|