C24H24ClN3O — CID 158070918
1-[4-[3-(4-chloro-5-methyl-3-pyridinyl)-5-isocyano-6-methylindol-1-yl]cyclohexyl]ethanone (PubChem CID 158070918) has the molecular formula C24H24ClN3O and a molecular weight of 405.93 g/mol. Its IUPAC name is 1-[4-[3-(4-chloro-5-methyl-3-pyridinyl)-5-isocyano-6-methylindol-1-yl]cyclohexyl]ethanone.
| Compound Name | 1-[4-[3-(4-chloro-5-methyl-3-pyridinyl)-5-isocyano-6-methylindol-1-yl]cyclohexyl]ethanone |
|---|---|
| PubChem CID | 158070918 |
| Molecular Formula | C24H24ClN3O |
| Molecular Weight | 405.93 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | 1-[4-[3-(4-chloro-5-methyl-3-pyridinyl)-5-isocyano-6-methylindol-1-yl]cyclohexyl]ethanone |
| SMILES | [C-]#[N+]c1cc2c(-c3cncc(C)c3Cl)cn(C3CCC(C(C)=O)CC3)c2cc1C |
| InChI | InChI=1S/C24H24ClN3O/c1-14-9-23-19(10-22(14)26-4)21(20-12-27-11-15(2)24(20)25)13-28(23)18-7-5-17(6-8-18)16(3)29/h9-13,17-18H,5-8H2,1-3H3 |
| InChIKey | CZGMUNSPCIZBNB-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 39.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.93 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|