C22H23BrN8O4 — CID 158071803
9-amino-8-bromo-1-methyl-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-2-one;9-amino-1-methyl-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-2-one (PubChem CID 158071803) has the molecular formula C22H23BrN8O4 and a molecular weight of 543.38 g/mol. Its IUPAC name is 9-amino-8-bromo-1-methyl-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-2-one;9-amino-1-methyl-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-2-one.
| Compound Name | 9-amino-8-bromo-1-methyl-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-2-one;9-amino-1-methyl-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-2-one |
|---|---|
| PubChem CID | 158071803 |
| Molecular Formula | C22H23BrN8O4 |
| Molecular Weight | 543.38 g/mol |
| Exact Mass | 542.10 |
| IUPAC Name | 9-amino-8-bromo-1-methyl-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-2-one;9-amino-1-methyl-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-2-one |
| SMILES | CC1C(=O)NN=C2COc3cc(Br)c(N)cc3N21.CC1C(=O)NN=C2COc3ccc(N)cc3N21 |
| InChI | InChI=1S/C11H11BrN4O2.C11H12N4O2/c1-5-11(17)15-14-10-4-18-9-2-6(12)7(13)3-8(9)16(5)10;1-6-11(16)14-13-10-5-17-9-3-2-7(12)4-8(9)15(6)10/h2-3,5H,4,13H2,1H3,(H,15,17);2-4,6H,5,12H2,1H3,(H,14,16) |
| InChIKey | FLXFFGNSYSXCBH-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 159.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.38 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|