About di(cyclopenta-2,4-dien-1-yl)methanethione
di(cyclopenta-2,4-dien-1-yl)methanethione (PubChem CID 15807229) has the molecular formula C11H10S
and a molecular weight of 174.27 g/mol. Its IUPAC name is di(cyclopenta-2,4-dien-1-yl)methanethione.
Molecular Properties
| Compound Name | di(cyclopenta-2,4-dien-1-yl)methanethione |
| PubChem CID | 15807229 |
| Molecular Formula | C11H10S |
| Molecular Weight | 174.27 g/mol |
| Exact Mass | 174.05 |
| IUPAC Name | di(cyclopenta-2,4-dien-1-yl)methanethione |
| SMILES | S=C(C1C=CC=C1)C1C=CC=C1 |
| InChI | InChI=1S/C11H10S/c12-11(9-5-1-2-6-9)10-7-3-4-8-10/h1-10H |
| InChIKey | QRNSTDHLWUPAJB-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.27 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze di(cyclopenta-2,4-dien-1-yl)methanethione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of di(cyclopenta-2,4-dien-1-yl)methanethione?
The IUPAC name of di(cyclopenta-2,4-dien-1-yl)methanethione (CID 15807229) is di(cyclopenta-2,4-dien-1-yl)methanethione.
What is the SMILES notation for di(cyclopenta-2,4-dien-1-yl)methanethione?
The canonical SMILES for di(cyclopenta-2,4-dien-1-yl)methanethione is S=C(C1C=CC=C1)C1C=CC=C1.
What is the InChIKey of di(cyclopenta-2,4-dien-1-yl)methanethione?
The InChIKey is QRNSTDHLWUPAJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10S/c12-11(9-5-1-2-6-9)10-7-3-4-8-10/h1-10H.
What are the key properties of di(cyclopenta-2,4-dien-1-yl)methanethione?
di(cyclopenta-2,4-dien-1-yl)methanethione has a molecular weight of 174.27 g/mol, XLogP of 2.84, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for di(cyclopenta-2,4-dien-1-yl)methanethione is sourced from PubChem (CID 15807229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).